C20H22F3N3O4 — CID 155851573
[1-(cyclopropylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155851573) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [1-(cyclopropylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851573 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [1-(cyclopropylmethyl)-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(=O)N2CCN(CC3CC3)c3ncccc3C2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O2.C2HF3O2/c1-13-4-7-16(23-13)18(22)21-10-9-20(11-14-5-6-14)17-15(12-21)3-2-8-19-17;3-2(4,5)1(6)7/h2-4,7-8,14H,5-6,9-12H2,1H3;(H,6,7) |
| InChIKey | ODXVQWMIAHTTMQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |