C21H31F3N2O6 — CID 155837498
(3aS,6aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155837498) has the molecular formula C21H31F3N2O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is (3aS,6aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837498 |
| Molecular Formula | C21H31F3N2O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (3aS,6aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-(oxan-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1C[C@@H]2COC[C@]2(COCC2CCOCC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N2O4.C2HF3O2/c1-14-18(15(2)25-20-14)8-21-7-17-10-24-13-19(17,11-21)12-23-9-16-3-5-22-6-4-16;3-2(4,5)1(6)7/h16-17H,3-13H2,1-2H3;(H,6,7)/t17-,19-;/m1./s1 |
| InChIKey | HWUAEHYAVHFBOB-POCMBTLOSA-N |
| XLogP | 2.82 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |