C18H23F3N4O5 — CID 155838668
(3aR,6S,7aR)-N-cyclopropyl-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155838668) has the molecular formula C18H23F3N4O5 and a molecular weight of 432.40 g/mol. Its IUPAC name is (3aR,6S,7aR)-N-cyclopropyl-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6S,7aR)-N-cyclopropyl-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838668 |
| Molecular Formula | C18H23F3N4O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (3aR,6S,7aR)-N-cyclopropyl-4-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2C[C@@H](C(=O)NC3CC3)C[C@H]3OCC[C@H]32)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N4O3.C2HF3O2/c1-22-15-7-14(17-9-18-15)20-8-10(16(21)19-11-2-3-11)6-13-12(20)4-5-23-13;3-2(4,5)1(6)7/h7,9-13H,2-6,8H2,1H3,(H,19,21);(H,6,7)/t10-,12+,13+;/m0./s1 |
| InChIKey | GGACUAWKTYLLOL-JJZGMWGRSA-N |
| XLogP | 1.38 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |