C30H29F3N4O5 — CID 155838969
2-[(4-methoxyphenyl)methyl]-N-methyl-1-oxo-N-(pyridin-2-ylmethyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b]isoindole-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155838969) has the molecular formula C30H29F3N4O5 and a molecular weight of 582.58 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-N-methyl-1-oxo-N-(pyridin-2-ylmethyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b]isoindole-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-N-methyl-1-oxo-N-(pyridin-2-ylmethyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b]isoindole-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838969 |
| Molecular Formula | C30H29F3N4O5 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-N-methyl-1-oxo-N-(pyridin-2-ylmethyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b]isoindole-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CCCn3c(C(=O)N(C)Cc4ccccn4)c4ccccc4c3C2=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H28N4O3.C2HF3O2/c1-30(19-21-8-5-6-15-29-21)27(33)25-23-9-3-4-10-24(23)26-28(34)31(16-7-17-32(25)26)18-20-11-13-22(35-2)14-12-20;3-2(4,5)1(6)7/h3-6,8-15H,7,16-19H2,1-2H3;(H,6,7) |
| InChIKey | DFMIJGAEIVARNX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |