C19H24F6N4O4S — CID 155838994
4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(3,3,3-trifluoropropanoyl)-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155838994) has the molecular formula C19H24F6N4O4S and a molecular weight of 518.48 g/mol. Its IUPAC name is 4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(3,3,3-trifluoropropanoyl)-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(3,3,3-trifluoropropanoyl)-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838994 |
| Molecular Formula | C19H24F6N4O4S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(3,3,3-trifluoropropanoyl)-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCN(C)C(=O)C23CCN(C(=O)CC(F)(F)F)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23F3N4O2S.C2HF3O2/c1-12-21-13(11-27-12)10-24-8-7-22(2)15(26)16(24)3-5-23(6-4-16)14(25)9-17(18,19)20;3-2(4,5)1(6)7/h11H,3-10H2,1-2H3;(H,6,7) |
| InChIKey | YRFDRFVPDPNUAS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |