C16H19F3N4O3S — CID 155839386
7,8-dimethyl-N-(thiophen-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155839386) has the molecular formula C16H19F3N4O3S and a molecular weight of 404.41 g/mol. Its IUPAC name is 7,8-dimethyl-N-(thiophen-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 7,8-dimethyl-N-(thiophen-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839386 |
| Molecular Formula | C16H19F3N4O3S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 7,8-dimethyl-N-(thiophen-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1c2nc(C(=O)NCc3cccs3)cn2CCN1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N4OS.C2HF3O2/c1-10-13-16-12(9-18(13)6-5-17(10)2)14(19)15-8-11-4-3-7-20-11;3-2(4,5)1(6)7/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,15,19);(H,6,7) |
| InChIKey | ORJZZNKWDHWHFP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |