C20H25F6N5O6 — CID 155840351
[(3R,3aS,6aS)-5-pyrimidin-4-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155840351) has the molecular formula C20H25F6N5O6 and a molecular weight of 545.44 g/mol. Its IUPAC name is [(3R,3aS,6aS)-5-pyrimidin-4-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3R,3aS,6aS)-5-pyrimidin-4-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155840351 |
| Molecular Formula | C20H25F6N5O6 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | [(3R,3aS,6aS)-5-pyrimidin-4-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(C(=O)[C@H]2CO[C@@H]3CN(c4ccncn4)C[C@H]23)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N5O2.2C2HF3O2/c1-19-4-6-20(7-5-19)16(22)13-10-23-14-9-21(8-12(13)14)15-2-3-17-11-18-15;2*3-2(4,5)1(6)7/h2-3,11-14H,4-10H2,1H3;2*(H,6,7)/t12-,13+,14-;;/m1../s1 |
| InChIKey | GENISFQILWOKBW-HPKQIFIVSA-N |
| XLogP | 0.97 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |