C18H23F3N4O4 — CID 155827361
[(2R,3aS,7aS)-6-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155827361) has the molecular formula C18H23F3N4O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is [(2R,3aS,7aS)-6-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2R,3aS,7aS)-6-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827361 |
| Molecular Formula | C18H23F3N4O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(2R,3aS,7aS)-6-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@H]1C[C@@H]2CCN(c3ccncn3)C[C@H]2O1)N1CCCC1 |
| InChI | InChI=1S/C16H22N4O2.C2HF3O2/c21-16(19-6-1-2-7-19)13-9-12-4-8-20(10-14(12)22-13)15-3-5-17-11-18-15;3-2(4,5)1(6)7/h3,5,11-14H,1-2,4,6-10H2;(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | YFWTYOYANCZKPS-SOIKFHLCSA-N |
| XLogP | 1.72 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |