C16H24F3N3O4 — CID 155841702
(4aS,7aS)-7-(methoxymethyl)-4-[(1-methylimidazol-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155841702) has the molecular formula C16H24F3N3O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is (4aS,7aS)-7-(methoxymethyl)-4-[(1-methylimidazol-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7aS)-7-(methoxymethyl)-4-[(1-methylimidazol-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841702 |
| Molecular Formula | C16H24F3N3O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (4aS,7aS)-7-(methoxymethyl)-4-[(1-methylimidazol-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | COCC1CC[C@H]2[C@H]1OCCN2Cc1nccn1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23N3O2.C2HF3O2/c1-16-6-5-15-13(16)9-17-7-8-19-14-11(10-18-2)3-4-12(14)17;3-2(4,5)1(6)7/h5-6,11-12,14H,3-4,7-10H2,1-2H3;(H,6,7)/t11?,12-,14-;/m0./s1 |
| InChIKey | BOKRPRAKYOSZTD-CBDVGLMHSA-N |
| XLogP | 1.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |