C21H29F6N3O6 — CID 155854598
7-(imidazol-1-ylmethyl)-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155854598) has the molecular formula C21H29F6N3O6 and a molecular weight of 533.47 g/mol. Its IUPAC name is 7-(imidazol-1-ylmethyl)-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(imidazol-1-ylmethyl)-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155854598 |
| Molecular Formula | C21H29F6N3O6 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 7-(imidazol-1-ylmethyl)-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cn(CC2CCC3C2OCCN3CC2CCOCC2)cn1 |
| InChI | InChI=1S/C17H27N3O2.2C2HF3O2/c1-2-16-17(15(1)12-19-6-5-18-13-19)22-10-7-20(16)11-14-3-8-21-9-4-14;2*3-2(4,5)1(6)7/h5-6,13-17H,1-4,7-12H2;2*(H,6,7) |
| InChIKey | IIMNNJWAEBCJMY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |