C15H23F3N4O4S — CID 155844018
N-[[8-(cyclopropylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155844018) has the molecular formula C15H23F3N4O4S and a molecular weight of 412.43 g/mol. Its IUPAC name is N-[[8-(cyclopropylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[8-(cyclopropylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844018 |
| Molecular Formula | C15H23F3N4O4S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[[8-(cyclopropylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NCc1ncn2c1CN(CC1CC1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H22N4O2S.C2HF3O2/c1-20(18,19)15-7-12-13-9-16(8-11-3-4-11)5-2-6-17(13)10-14-12;3-2(4,5)1(6)7/h10-11,15H,2-9H2,1H3;(H,6,7) |
| InChIKey | MYYDRNUTLFOSBA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |