C17H25F3N4O4 — CID 155844337
2-[(8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-6-yl)methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155844337) has the molecular formula C17H25F3N4O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is 2-[(8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-6-yl)methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-6-yl)methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844337 |
| Molecular Formula | C17H25F3N4O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[(8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-6-yl)methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | CN1Cc2cncn2CC(COCC(=O)N2CCCC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O2.C2HF3O2/c1-17-7-13(8-19-12-16-6-14(19)9-17)10-21-11-15(20)18-4-2-3-5-18;3-2(4,5)1(6)7/h6,12-13H,2-5,7-11H2,1H3;(H,6,7) |
| InChIKey | LBHIRFLRIJWERC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |