C17H25F3N4O4S — CID 155844479
N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155844479) has the molecular formula C17H25F3N4O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844479 |
| Molecular Formula | C17H25F3N4O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N,N-dimethyl-4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)N1CCC2(CC1)CN(Cc1nccs1)CCO2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O2S.C2HF3O2/c1-17(2)14(20)19-6-3-15(4-7-19)12-18(8-9-21-15)11-13-16-5-10-22-13;3-2(4,5)1(6)7/h5,10H,3-4,6-9,11-12H2,1-2H3;(H,6,7) |
| InChIKey | FCCSPDNCTBSOLV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |