C19H25F3N4O6 — CID 155845508
2-[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155845508) has the molecular formula C19H25F3N4O6 and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845508 |
| Molecular Formula | C19H25F3N4O6 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2C[C@@H]3[C@H](CC(=O)N4CCCCO4)CO[C@@H]3C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O4.C2HF3O2/c1-23-16-7-15(18-11-19-16)20-8-13-12(10-24-14(13)9-20)6-17(22)21-4-2-3-5-25-21;3-2(4,5)1(6)7/h7,11-14H,2-6,8-10H2,1H3;(H,6,7)/t12-,13-,14-;/m1./s1 |
| InChIKey | XPAQNGMAVZVDHE-MBLYYGPHSA-N |
| XLogP | 1.51 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |