C17H20F3N5O5 — CID 155837226
(2R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155837226) has the molecular formula C17H20F3N5O5 and a molecular weight of 431.37 g/mol. Its IUPAC name is (2R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837226 |
| Molecular Formula | C17H20F3N5O5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (2R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2C[C@@H]3C[C@H](Cc4nc(C)no4)O[C@@H]3C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N5O3.C2HF3O2/c1-9-18-15(23-19-9)4-11-3-10-6-20(7-12(10)22-11)13-5-14(21-2)17-8-16-13;3-2(4,5)1(6)7/h5,8,10-12H,3-4,6-7H2,1-2H3;(H,6,7)/t10-,11+,12+;/m0./s1 |
| InChIKey | BEMRWKZLCLUMPO-YBWCDFGXSA-N |
| XLogP | 1.65 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |