C17H24N4O4 — CID 97483691
2-[(2S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone (PubChem CID 97483691) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[(2S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone.
| Compound Name | 2-[(2S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone |
|---|---|
| PubChem CID | 97483691 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[(2S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone |
| SMILES | COc1cc(N2C[C@@H]3C[C@@H](CC(=O)N4CCCCO4)O[C@@H]3C2)ncn1 |
| InChI | InChI=1S/C17H24N4O4/c1-23-16-8-15(18-11-19-16)20-9-12-6-13(25-14(12)10-20)7-17(22)21-4-2-3-5-24-21/h8,11-14H,2-7,9-10H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | IUZKGHBUPZZFGH-MELADBBJSA-N |
| XLogP | 1.02 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |