C18H21F3N4O4S — CID 155847749
7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155847749) has the molecular formula C18H21F3N4O4S and a molecular weight of 446.45 g/mol. Its IUPAC name is 7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847749 |
| Molecular Formula | C18H21F3N4O4S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 7-(pyrimidin-2-yloxymethyl)-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cnc(OCC2CCC3C2OCCN3Cc2nccs2)nc1 |
| InChI | InChI=1S/C16H20N4O2S.C2HF3O2/c1-4-18-16(19-5-1)22-11-12-2-3-13-15(12)21-8-7-20(13)10-14-17-6-9-23-14;3-2(4,5)1(6)7/h1,4-6,9,12-13,15H,2-3,7-8,10-11H2;(H,6,7) |
| InChIKey | LNYSHYMAAZLGGA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |