C19H22F3N3O4S — CID 155837648
7-(pyrimidin-2-yloxymethyl)-4-(thiophen-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155837648) has the molecular formula C19H22F3N3O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is 7-(pyrimidin-2-yloxymethyl)-4-(thiophen-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(pyrimidin-2-yloxymethyl)-4-(thiophen-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837648 |
| Molecular Formula | C19H22F3N3O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 7-(pyrimidin-2-yloxymethyl)-4-(thiophen-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cnc(OCC2CCC3C2OCCN3Cc2ccsc2)nc1 |
| InChI | InChI=1S/C17H21N3O2S.C2HF3O2/c1-5-18-17(19-6-1)22-11-14-2-3-15-16(14)21-8-7-20(15)10-13-4-9-23-12-13;3-2(4,5)1(6)7/h1,4-6,9,12,14-16H,2-3,7-8,10-11H2;(H,6,7) |
| InChIKey | DQRPFEZNJVDNQP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |