C22H26F6N4O5S — CID 155847462
N-[2-[(3aS,7aR)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847462) has the molecular formula C22H26F6N4O5S and a molecular weight of 572.53 g/mol. Its IUPAC name is N-[2-[(3aS,7aR)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[2-[(3aS,7aR)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847462 |
| Molecular Formula | C22H26F6N4O5S |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | N-[2-[(3aS,7aR)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(NCC[C@@]23CCO[C@@H]2CCN(Cc2ccsc2)C3)nc1 |
| InChI | InChI=1S/C18H24N4OS.2C2HF3O2/c1-6-19-17(20-7-1)21-8-4-18-5-10-23-16(18)2-9-22(14-18)12-15-3-11-24-13-15;2*3-2(4,5)1(6)7/h1,3,6-7,11,13,16H,2,4-5,8-10,12,14H2,(H,19,20,21);2*(H,6,7)/t16-,18+;;/m1../s1 |
| InChIKey | VRCMLEKJEVSVLO-UFUZANHXSA-N |
| XLogP | 4.29 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |