C19H21F3N4O4S — CID 155834573
[(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155834573) has the molecular formula C19H21F3N4O4S and a molecular weight of 458.46 g/mol. Its IUPAC name is [(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834573 |
| Molecular Formula | C19H21F3N4O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1CC[C@@H]2[C@@H](CO[C@H]2CNc2ncccn2)C1 |
| InChI | InChI=1S/C17H20N4O2S.C2HF3O2/c22-16(12-3-7-24-11-12)21-6-2-14-13(9-21)10-23-15(14)8-20-17-18-4-1-5-19-17;3-2(4,5)1(6)7/h1,3-5,7,11,13-15H,2,6,8-10H2,(H,18,19,20);(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | QRRFDBZVVLGLAG-QRWISWEOSA-N |
| XLogP | 2.76 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |