C22H22F3N3O4 — CID 155847927
(4-ethoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-quinolin-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155847927) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is (4-ethoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-quinolin-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-ethoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-quinolin-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847927 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (4-ethoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-quinolin-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCOC1CN(C(=O)c2cnc3ccccc3c2)Cc2cccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N3O2.C2HF3O2/c1-2-25-18-13-22-9-5-7-17(22)12-23(14-18)20(24)16-10-15-6-3-4-8-19(15)21-11-16;3-2(4,5)1(6)7/h3-11,18H,2,12-14H2,1H3;(H,6,7) |
| InChIKey | XYCURWNWNZVDPR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |