C15H21F3N4O5S2 — CID 155848858
(2R,3aR,6aR)-N-methyl-1-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155848858) has the molecular formula C15H21F3N4O5S2 and a molecular weight of 458.48 g/mol. Its IUPAC name is (2R,3aR,6aR)-N-methyl-1-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aR,6aR)-N-methyl-1-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848858 |
| Molecular Formula | C15H21F3N4O5S2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (2R,3aR,6aR)-N-methyl-1-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CN(Cc3nccs3)C[C@@H]2N1S(C)(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N4O3S2.C2HF3O2/c1-14-13(18)10-5-9-6-16(8-12-15-3-4-21-12)7-11(9)17(10)22(2,19)20;3-2(4,5)1(6)7/h3-4,9-11H,5-8H2,1-2H3,(H,14,18);(H,6,7)/t9-,10-,11+;/m1./s1 |
| InChIKey | FBYLOCSQGPHGRR-NQHCQCOHSA-N |
| XLogP | 0.36 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |