C21H30F6N4O5S — CID 155850074
1-methyl-4-(2-methylpropyl)-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155850074) has the molecular formula C21H30F6N4O5S and a molecular weight of 564.55 g/mol. Its IUPAC name is 1-methyl-4-(2-methylpropyl)-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-methyl-4-(2-methylpropyl)-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155850074 |
| Molecular Formula | C21H30F6N4O5S |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 1-methyl-4-(2-methylpropyl)-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)CN1CCN(C)C2(CCN(Cc3nccs3)CC2)C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N4OS.2C2HF3O2/c1-14(2)12-21-10-9-19(3)17(16(21)22)4-7-20(8-5-17)13-15-18-6-11-23-15;2*3-2(4,5)1(6)7/h6,11,14H,4-5,7-10,12-13H2,1-3H3;2*(H,6,7) |
| InChIKey | VOGPGYJKNJFRSA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |