C22H30F6N6O6 — CID 155850642
2-(2-methoxyethyl)-4-(methoxymethyl)-8-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2,8-diazaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155850642) has the molecular formula C22H30F6N6O6 and a molecular weight of 588.51 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-4-(methoxymethyl)-8-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2,8-diazaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(2-methoxyethyl)-4-(methoxymethyl)-8-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2,8-diazaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155850642 |
| Molecular Formula | C22H30F6N6O6 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 2-(2-methoxyethyl)-4-(methoxymethyl)-8-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2,8-diazaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1CC(COC)C2(CCN(c3ccc4nncn4n3)CC2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N6O2.2C2HF3O2/c1-25-10-9-22-11-15(12-26-2)18(13-22)5-7-23(8-6-18)17-4-3-16-20-19-14-24(16)21-17;2*3-2(4,5)1(6)7/h3-4,14-15H,5-13H2,1-2H3;2*(H,6,7) |
| InChIKey | CLPWRVQVZMIMIH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |