C22H28F6N6O5 — CID 155847055
6-[8-(cyclopropylmethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847055) has the molecular formula C22H28F6N6O5 and a molecular weight of 570.49 g/mol. Its IUPAC name is 6-[8-(cyclopropylmethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-[8-(cyclopropylmethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847055 |
| Molecular Formula | C22H28F6N6O5 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 6-[8-(cyclopropylmethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCC(COCC2CC2)CC12CN(c1ccc3nncn3n1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N6O.2C2HF3O2/c1-22-7-6-15(10-25-9-14-2-3-14)8-18(22)11-23(12-18)17-5-4-16-20-19-13-24(16)21-17;2*3-2(4,5)1(6)7/h4-5,13-15H,2-3,6-12H2,1H3;2*(H,6,7) |
| InChIKey | OSKCBPWTYDBLLG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |