C23H24F6N6O6 — CID 155854664
8-[2-(pyridin-4-ylmethoxy)ethyl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5-oxa-2-azaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155854664) has the molecular formula C23H24F6N6O6 and a molecular weight of 594.47 g/mol. Its IUPAC name is 8-[2-(pyridin-4-ylmethoxy)ethyl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5-oxa-2-azaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-[2-(pyridin-4-ylmethoxy)ethyl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5-oxa-2-azaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155854664 |
| Molecular Formula | C23H24F6N6O6 |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 8-[2-(pyridin-4-ylmethoxy)ethyl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5-oxa-2-azaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cc(COCCC2CCOC23CN(c2ccc4nncn4n2)C3)ccn1 |
| InChI | InChI=1S/C19H22N6O2.2C2HF3O2/c1-2-18(23-25-14-21-22-17(1)25)24-12-19(13-24)16(6-10-27-19)5-9-26-11-15-3-7-20-8-4-15;2*3-2(4,5)1(6)7/h1-4,7-8,14,16H,5-6,9-13H2;2*(H,6,7) |
| InChIKey | QMPPPWSNVDWOGA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 152.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|