C21H29F3N2O4 — CID 155852579
(5S,10R)-10-ethyl-9-(2-phenylmethoxyethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155852579) has the molecular formula C21H29F3N2O4 and a molecular weight of 430.47 g/mol. Its IUPAC name is (5S,10R)-10-ethyl-9-(2-phenylmethoxyethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5S,10R)-10-ethyl-9-(2-phenylmethoxyethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852579 |
| Molecular Formula | C21H29F3N2O4 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (5S,10R)-10-ethyl-9-(2-phenylmethoxyethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H]1N(CCOCc2ccccc2)CCC[C@]12CCC(=O)N2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N2O2.C2HF3O2/c1-2-17-19(11-9-18(22)20-19)10-6-12-21(17)13-14-23-15-16-7-4-3-5-8-16;3-2(4,5)1(6)7/h3-5,7-8,17H,2,6,9-15H2,1H3,(H,20,22);(H,6,7)/t17-,19+;/m1./s1 |
| InChIKey | YRDBQTSPISEGFE-ZFNKBKEPSA-N |
| XLogP | 3.36 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|