C21H32N2O3 — CID 56907530
1-[(4aS,8aR)-4a-(hydroxymethyl)-1-(3-phenylmethoxypropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-6-yl]ethanone (PubChem CID 56907530) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-(hydroxymethyl)-1-(3-phenylmethoxypropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-6-yl]ethanone.
| Compound Name | 1-[(4aS,8aR)-4a-(hydroxymethyl)-1-(3-phenylmethoxypropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 56907530 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 1-[(4aS,8aR)-4a-(hydroxymethyl)-1-(3-phenylmethoxypropyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-6-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2N(CCCOCc3ccccc3)CCC[C@]2(CO)C1 |
| InChI | InChI=1S/C21H32N2O3/c1-18(25)23-13-9-20-21(16-23,17-24)10-5-11-22(20)12-6-14-26-15-19-7-3-2-4-8-19/h2-4,7-8,20,24H,5-6,9-17H2,1H3/t20-,21-/m1/s1 |
| InChIKey | SECQTAKJCGCEEV-NHCUHLMSSA-N |
| XLogP | 2.29 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|