C20H24F6N2O6 — CID 155852589
(4aS,7S,7aR)-4-cyclobutyl-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852589) has the molecular formula C20H24F6N2O6 and a molecular weight of 502.41 g/mol. Its IUPAC name is (4aS,7S,7aR)-4-cyclobutyl-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,7S,7aR)-4-cyclobutyl-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852589 |
| Molecular Formula | C20H24F6N2O6 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (4aS,7S,7aR)-4-cyclobutyl-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(O[C@H]2CC[C@H]3[C@H]2OCCN3C2CCC2)nc1 |
| InChI | InChI=1S/C16H22N2O2.2C2HF3O2/c1-2-9-17-15(6-1)20-14-8-7-13-16(14)19-11-10-18(13)12-4-3-5-12;2*3-2(4,5)1(6)7/h1-2,6,9,12-14,16H,3-5,7-8,10-11H2;2*(H,6,7)/t13-,14-,16+;;/m0../s1 |
| InChIKey | URZCJWWRBNDPRO-KDVSYEBASA-N |
| XLogP | 3.51 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |