C21H25F3N2O5 — CID 155864189
[(3aS,7R,7aS)-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(cyclohexen-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155864189) has the molecular formula C21H25F3N2O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is [(3aS,7R,7aS)-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(cyclohexen-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aS,7R,7aS)-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(cyclohexen-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864189 |
| Molecular Formula | C21H25F3N2O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [(3aS,7R,7aS)-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(cyclohexen-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1=CCCCC1)N1CC[C@@H](Oc2ccccn2)[C@H]2OCC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N2O3.C2HF3O2/c22-19(14-6-2-1-3-7-14)21-12-9-16(18-15(21)10-13-23-18)24-17-8-4-5-11-20-17;3-2(4,5)1(6)7/h4-6,8,11,15-16,18H,1-3,7,9-10,12-13H2;(H,6,7)/t15-,16+,18-;/m0./s1 |
| InChIKey | TXKRPRAHDUAGIZ-UHJKVRLHSA-N |
| XLogP | 3.35 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |