C19H19F5N2O3S2 — CID 155853448
(3aR,6aS)-5-(2,5-dimethylthiophen-3-yl)-3a,6a-difluoro-2-(thiophen-2-ylmethyl)-3,6-dihydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid (PubChem CID 155853448) has the molecular formula C19H19F5N2O3S2 and a molecular weight of 482.50 g/mol. Its IUPAC name is (3aR,6aS)-5-(2,5-dimethylthiophen-3-yl)-3a,6a-difluoro-2-(thiophen-2-ylmethyl)-3,6-dihydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-5-(2,5-dimethylthiophen-3-yl)-3a,6a-difluoro-2-(thiophen-2-ylmethyl)-3,6-dihydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853448 |
| Molecular Formula | C19H19F5N2O3S2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (3aR,6aS)-5-(2,5-dimethylthiophen-3-yl)-3a,6a-difluoro-2-(thiophen-2-ylmethyl)-3,6-dihydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N2C[C@@]3(F)CN(Cc4cccs4)C[C@@]3(F)C2=O)c(C)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H18F2N2OS2.C2HF3O2/c1-11-6-14(12(2)24-11)21-9-16(18)8-20(7-13-4-3-5-23-13)10-17(16,19)15(21)22;3-2(4,5)1(6)7/h3-6H,7-10H2,1-2H3;(H,6,7)/t16-,17+;/m0./s1 |
| InChIKey | MQZXTWANWSMIKS-MCJVGQIASA-N |
| XLogP | 4.34 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |