C20H24F6N6O6 — CID 155855049
2-(dimethylamino)-1-[3-(pyridin-3-ylmethoxymethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155855049) has the molecular formula C20H24F6N6O6 and a molecular weight of 558.44 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[3-(pyridin-3-ylmethoxymethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(dimethylamino)-1-[3-(pyridin-3-ylmethoxymethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155855049 |
| Molecular Formula | C20H24F6N6O6 |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 2-(dimethylamino)-1-[3-(pyridin-3-ylmethoxymethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CC(=O)N1CCn2c(COCc3cccnc3)nnc2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N6O2.2C2HF3O2/c1-20(2)10-16(23)21-6-7-22-14(9-21)18-19-15(22)12-24-11-13-4-3-5-17-8-13;2*3-2(4,5)1(6)7/h3-5,8H,6-7,9-12H2,1-2H3;2*(H,6,7) |
| InChIKey | JUFKLDZMUKQNTC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |