C19H24F5N3O3S — CID 155855518
cyclopropyl-[10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155855518) has the molecular formula C19H24F5N3O3S and a molecular weight of 469.48 g/mol. Its IUPAC name is cyclopropyl-[10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopropyl-[10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855518 |
| Molecular Formula | C19H24F5N3O3S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | cyclopropyl-[10,10-difluoro-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decan-7-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCC3(C2)CN(C(=O)C2CC2)CCC3(F)F)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23F2N3OS.C2HF3O2/c1-12-20-14(9-24-12)8-21-6-4-16(10-21)11-22(7-5-17(16,18)19)15(23)13-2-3-13;3-2(4,5)1(6)7/h9,13H,2-8,10-11H2,1H3;(H,6,7) |
| InChIKey | UGLXCRDRLQTDGP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |