C19H24F3N3O3S — CID 155855681
6-(cyclopropylmethoxymethyl)-8-(thiophen-3-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 155855681) has the molecular formula C19H24F3N3O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is 6-(cyclopropylmethoxymethyl)-8-(thiophen-3-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(cyclopropylmethoxymethyl)-8-(thiophen-3-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855681 |
| Molecular Formula | C19H24F3N3O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 6-(cyclopropylmethoxymethyl)-8-(thiophen-3-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc(CN2Cc3cncn3CC(COCC3CC3)C2)cs1 |
| InChI | InChI=1S/C17H23N3OS.C2HF3O2/c1-2-14(1)10-21-11-16-7-19(6-15-3-4-22-12-15)9-17-5-18-13-20(17)8-16;3-2(4,5)1(6)7/h3-5,12-14,16H,1-2,6-11H2;(H,6,7) |
| InChIKey | ZSNIWCXAVIWVLQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |