C21H28F3N3O4S — CID 155866449
N,N-dimethyl-2-[2-[2-(thiophen-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155866449) has the molecular formula C21H28F3N3O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[2-(thiophen-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[2-[2-(thiophen-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866449 |
| Molecular Formula | C21H28F3N3O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N,N-dimethyl-2-[2-[2-(thiophen-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COCCC1CN(Cc2ccsc2)Cc2cccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N3O2S.C2HF3O2/c1-20(2)19(23)14-24-8-5-16-10-21(11-17-6-9-25-15-17)13-18-4-3-7-22(18)12-16;3-2(4,5)1(6)7/h3-4,6-7,9,15-16H,5,8,10-14H2,1-2H3;(H,6,7) |
| InChIKey | YGNHNOYVGOIXGM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|