C22H28F3N3O5 — CID 155866468
2-[2-[(3,5-dimethoxyphenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-methylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155866468) has the molecular formula C22H28F3N3O5 and a molecular weight of 471.48 g/mol. Its IUPAC name is 2-[2-[(3,5-dimethoxyphenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-methylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[(3,5-dimethoxyphenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-methylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866468 |
| Molecular Formula | C22H28F3N3O5 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[2-[(3,5-dimethoxyphenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-methylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)CC1CN(Cc2cc(OC)cc(OC)c2)Cc2cccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O3.C2HF3O2/c1-21-20(24)9-16-12-22(14-17-5-4-6-23(17)13-16)11-15-7-18(25-2)10-19(8-15)26-3;3-2(4,5)1(6)7/h4-8,10,16H,9,11-14H2,1-3H3,(H,21,24);(H,6,7) |
| InChIKey | NPABJDNBKRHQEX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |