C22H27F4N3O4 — CID 155866850
2-[2-[(2-fluorophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155866850) has the molecular formula C22H27F4N3O4 and a molecular weight of 473.47 g/mol. Its IUPAC name is 2-[2-[(2-fluorophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[(2-fluorophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866850 |
| Molecular Formula | C22H27F4N3O4 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[2-[(2-fluorophenyl)methyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)CC1CN(Cc2ccccc2F)Cc2cccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26FN3O2.C2HF3O2/c1-26-10-8-22-20(25)11-16-12-23(14-17-5-2-3-7-19(17)21)15-18-6-4-9-24(18)13-16;3-2(4,5)1(6)7/h2-7,9,16H,8,10-15H2,1H3,(H,22,25);(H,6,7) |
| InChIKey | YLWGFXRQOGVEHY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|