C19H28F3N3O4 — CID 155829360
2-cyclopentyl-N-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829360) has the molecular formula C19H28F3N3O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-cyclopentyl-N-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclopentyl-N-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829360 |
| Molecular Formula | C19H28F3N3O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-cyclopentyl-N-(2-methoxyethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)C1CN(C2CCCC2)Cc2cccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O2.C2HF3O2/c1-22-10-8-18-17(21)14-11-19-9-4-7-16(19)13-20(12-14)15-5-2-3-6-15;3-2(4,5)1(6)7/h4,7,9,14-15H,2-3,5-6,8,10-13H2,1H3,(H,18,21);(H,6,7) |
| InChIKey | QZRLMHSPBOXRBD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|