C19H30N4O3 — CID 56868672
N-(2-methoxyethyl)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 56868672) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56868672 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N-(2-methoxyethyl)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(C2CCN(C(=O)c3ccc[nH]3)CC2)C1 |
| InChI | InChI=1S/C19H30N4O3/c1-26-13-9-21-18(24)15-4-3-10-23(14-15)16-6-11-22(12-7-16)19(25)17-5-2-8-20-17/h2,5,8,15-16,20H,3-4,6-7,9-14H2,1H3,(H,21,24) |
| InChIKey | WQWAPRMBDQAGQB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|