C19H30N4O3S — CID 95555709
(3S)-N-(2-methoxyethyl)-1-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 95555709) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is (3S)-N-(2-methoxyethyl)-1-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxyethyl)-1-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95555709 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3S)-N-(2-methoxyethyl)-1-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCCN(C2CCN(C(=O)c3scnc3C)CC2)C1 |
| InChI | InChI=1S/C19H30N4O3S/c1-14-17(27-13-21-14)19(25)22-9-5-16(6-10-22)23-8-3-4-15(12-23)18(24)20-7-11-26-2/h13,15-16H,3-12H2,1-2H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | FANTUROZWWBYNG-HNNXBMFYSA-N |
| XLogP | 1.53 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|