C20H25F4N5O4 — CID 155866820
2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155866820) has the molecular formula C20H25F4N5O4 and a molecular weight of 475.44 g/mol. Its IUPAC name is 2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866820 |
| Molecular Formula | C20H25F4N5O4 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[2-[2-(5-fluoropyrimidin-2-yl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COCCC1CN(c2ncc(F)cn2)Cc2cccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24FN5O2.C2HF3O2/c1-22(2)17(25)13-26-7-5-14-10-23-6-3-4-16(23)12-24(11-14)18-20-8-15(19)9-21-18;3-2(4,5)1(6)7/h3-4,6,8-9,14H,5,7,10-13H2,1-2H3;(H,6,7) |
| InChIKey | FPYPJFLZYAQPOR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|