C18H26N4O2S — CID 131695958
N,N-dimethyl-2-[2-[2-(1,3-thiazol-2-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide (PubChem CID 131695958) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[2-(1,3-thiazol-2-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide.
| Compound Name | N,N-dimethyl-2-[2-[2-(1,3-thiazol-2-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 131695958 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N,N-dimethyl-2-[2-[2-(1,3-thiazol-2-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-4-yl]ethoxy]acetamide |
| SMILES | CN(C)C(=O)COCCC1CN(Cc2nccs2)Cc2cccn2C1 |
| InChI | InChI=1S/C18H26N4O2S/c1-20(2)18(23)14-24-8-5-15-10-21(13-17-19-6-9-25-17)12-16-4-3-7-22(16)11-15/h3-4,6-7,9,15H,5,8,10-14H2,1-2H3 |
| InChIKey | FMIWJCIWKGOUES-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|