C19H27F3N2O5 — CID 155855935
N-[[(3aR,6aR)-5-(furan-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 155855935) has the molecular formula C19H27F3N2O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-(furan-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aR,6aR)-5-(furan-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855935 |
| Molecular Formula | C19H27F3N2O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[[(3aR,6aR)-5-(furan-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CC(=O)NC[C@]12COC[C@H]1CN(Cc1ccoc1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O3.C2HF3O2/c1-13(2)5-16(20)18-10-17-11-19(6-14-3-4-21-8-14)7-15(17)9-22-12-17;3-2(4,5)1(6)7/h3-4,8,13,15H,5-7,9-12H2,1-2H3,(H,18,20);(H,6,7)/t15-,17+;/m1./s1 |
| InChIKey | KPCNWLWVINMCOO-KALLACGZSA-N |
| XLogP | 2.52 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |