C18H26F3N3O4S — CID 155835430
3-[[(3aR,6aR)-5-[(5-methylthiophen-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 155835430) has the molecular formula C18H26F3N3O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 3-[[(3aR,6aR)-5-[(5-methylthiophen-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3aR,6aR)-5-[(5-methylthiophen-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835430 |
| Molecular Formula | C18H26F3N3O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-[[(3aR,6aR)-5-[(5-methylthiophen-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C[C@@H]3COC[C@]3(CNC(=O)N(C)C)C2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O2S.C2HF3O2/c1-12-4-5-14(22-12)7-19-6-13-8-21-11-16(13,10-19)9-17-15(20)18(2)3;3-2(4,5)1(6)7/h4-5,13H,6-11H2,1-3H3,(H,17,20);(H,6,7)/t13-,16+;/m1./s1 |
| InChIKey | BDDNPPQNIZKMHP-CACIRBSMSA-N |
| XLogP | 2.41 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |