C17H22ClN3O2 — CID 15585627
1-[2-chloro-6-(1-imidazol-1-ylethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 15585627) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 1-[2-chloro-6-(1-imidazol-1-ylethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[2-chloro-6-(1-imidazol-1-ylethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 15585627 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[2-chloro-6-(1-imidazol-1-ylethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | C=C(c1cccc(Cl)c1OCC(O)CNC(C)C)n1ccnc1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-12(2)20-9-14(22)10-23-17-15(5-4-6-16(17)18)13(3)21-8-7-19-11-21/h4-8,11-12,14,20,22H,3,9-10H2,1-2H3 |
| InChIKey | LOSCYEZRALCXJE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |