C21H32F6N4O6 — CID 155857156
N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155857156) has the molecular formula C21H32F6N4O6 and a molecular weight of 550.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155857156 |
| Molecular Formula | C21H32F6N4O6 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCOCc1ncn2c1CN(C1CCOCC1)CCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H30N4O2.2C2HF3O2/c1-19(2)8-11-23-13-16-17-12-20(15-4-9-22-10-5-15)6-3-7-21(17)14-18-16;2*3-2(4,5)1(6)7/h14-15H,3-13H2,1-2H3;2*(H,6,7) |
| InChIKey | QVWCSHPLUACIIX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|