C21H25ClF3N5O3 — CID 155857316
(4-chlorophenyl)-[3-(piperidin-1-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155857316) has the molecular formula C21H25ClF3N5O3 and a molecular weight of 487.91 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-(piperidin-1-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-chlorophenyl)-[3-(piperidin-1-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857316 |
| Molecular Formula | C21H25ClF3N5O3 |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (4-chlorophenyl)-[3-(piperidin-1-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccc(Cl)cc1)N1CCCn2nnc(CN3CCCCC3)c2C1 |
| InChI | InChI=1S/C19H24ClN5O.C2HF3O2/c20-16-7-5-15(6-8-16)19(26)24-11-4-12-25-18(14-24)17(21-22-25)13-23-9-2-1-3-10-23;3-2(4,5)1(6)7/h5-8H,1-4,9-14H2;(H,6,7) |
| InChIKey | VEFHBMLLHFPPNT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |