C15H19F3N4O3S — CID 155857609
[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methanol;2,2,2-trifluoroacetic acid (PubChem CID 155857609) has the molecular formula C15H19F3N4O3S and a molecular weight of 392.40 g/mol. Its IUPAC name is [5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methanol;2,2,2-trifluoroacetic acid.
| Compound Name | [5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857609 |
| Molecular Formula | C15H19F3N4O3S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methanol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCCn3nnc(CO)c3C2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18N4OS.C2HF3O2/c1-10-3-4-11(19-10)7-16-5-2-6-17-13(8-16)12(9-18)14-15-17;3-2(4,5)1(6)7/h3-4,18H,2,5-9H2,1H3;(H,6,7) |
| InChIKey | JUXULQMQMBKUGE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |