C16H21F3N4O4S — CID 155856931
2-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 155856931) has the molecular formula C16H21F3N4O4S and a molecular weight of 422.43 g/mol. Its IUPAC name is 2-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155856931 |
| Molecular Formula | C16H21F3N4O4S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OCCOCc1nnn2c1CN(Cc1ccsc1)CCC2 |
| InChI | InChI=1S/C14H20N4O2S.C2HF3O2/c19-5-6-20-10-13-14-9-17(8-12-2-7-21-11-12)3-1-4-18(14)16-15-13;3-2(4,5)1(6)7/h2,7,11,19H,1,3-6,8-10H2;(H,6,7) |
| InChIKey | CSSYHAHQFXDAJO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|