C17H24F3N5O4 — CID 155847445
2-[[8-[(1-methylpyrazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 155847445) has the molecular formula C17H24F3N5O4 and a molecular weight of 419.40 g/mol. Its IUPAC name is 2-[[8-[(1-methylpyrazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[8-[(1-methylpyrazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847445 |
| Molecular Formula | C17H24F3N5O4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[[8-[(1-methylpyrazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2CCCn3cnc(COCCO)c3C2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N5O2.C2HF3O2/c1-18-8-13(7-17-18)9-19-3-2-4-20-12-16-14(15(20)10-19)11-22-6-5-21;3-2(4,5)1(6)7/h7-8,12,21H,2-6,9-11H2,1H3;(H,6,7) |
| InChIKey | YXODOOXUEMPRQS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|